C20H29NO5 — CID 175696183
(2S)-2-[3-(4-butoxy-3-methoxyphenyl)prop-2-enoylamino]-4-methylpentanoic acid (PubChem CID 175696183) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is (2S)-2-[3-(4-butoxy-3-methoxyphenyl)prop-2-enoylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[3-(4-butoxy-3-methoxyphenyl)prop-2-enoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 175696183 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | (2S)-2-[3-(4-butoxy-3-methoxyphenyl)prop-2-enoylamino]-4-methylpentanoic acid |
| SMILES | CCCCOc1ccc(C=CC(=O)N[C@@H](CC(C)C)C(=O)O)cc1OC |
| InChI | InChI=1S/C20H29NO5/c1-5-6-11-26-17-9-7-15(13-18(17)25-4)8-10-19(22)21-16(20(23)24)12-14(2)3/h7-10,13-14,16H,5-6,11-12H2,1-4H3,(H,21,22)(H,23,24)/t16-/m0/s1 |
| InChIKey | XQADOVGHFDREAP-INIZCTEOSA-N |
| XLogP | 3.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|