C18H15ClFN3OS — CID 175696730
2-(3-chloro-4-fluorophenyl)-3-[(3-cyano-6-cyclopropyl-2-pyridinyl)sulfanyl]propanamide (PubChem CID 175696730) has the molecular formula C18H15ClFN3OS and a molecular weight of 375.86 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-3-[(3-cyano-6-cyclopropyl-2-pyridinyl)sulfanyl]propanamide.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-3-[(3-cyano-6-cyclopropyl-2-pyridinyl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 175696730 |
| Molecular Formula | C18H15ClFN3OS |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-3-[(3-cyano-6-cyclopropyl-2-pyridinyl)sulfanyl]propanamide |
| SMILES | N#Cc1ccc(C2CC2)nc1SCC(C(N)=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H15ClFN3OS/c19-14-7-11(3-5-15(14)20)13(17(22)24)9-25-18-12(8-21)4-6-16(23-18)10-1-2-10/h3-7,10,13H,1-2,9H2,(H2,22,24) |
| InChIKey | USFNRPVUTXABRQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |