C29H40O6P+ — CID 175697667
benzoic acid;3-butyl-3-methylpentane-2,4-diol;dihydroxy(diphenyl)phosphanium (PubChem CID 175697667) has the molecular formula C29H40O6P+ and a molecular weight of 515.61 g/mol. Its IUPAC name is benzoic acid;3-butyl-3-methylpentane-2,4-diol;dihydroxy(diphenyl)phosphanium.
| Compound Name | benzoic acid;3-butyl-3-methylpentane-2,4-diol;dihydroxy(diphenyl)phosphanium |
|---|---|
| PubChem CID | 175697667 |
| Molecular Formula | C29H40O6P+ |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | benzoic acid;3-butyl-3-methylpentane-2,4-diol;dihydroxy(diphenyl)phosphanium |
| SMILES | CCCCC(C)(C(C)O)C(C)O.O=C(O)c1ccccc1.O[P+](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H12O2P.C10H22O2.C7H6O2/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5-6-7-10(4,8(2)11)9(3)12;8-7(9)6-4-2-1-3-5-6/h1-10,13-14H;8-9,11-12H,5-7H2,1-4H3;1-5H,(H,8,9)/q+1;; |
| InChIKey | NRAWVSBNPYNEBK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|