C9H10FN5O6 — CID 175698433
1-[(2S,3R,4S,5R)-5-azido-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 175698433) has the molecular formula C9H10FN5O6 and a molecular weight of 303.21 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R)-5-azido-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3R,4S,5R)-5-azido-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175698433 |
| Molecular Formula | C9H10FN5O6 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 1-[(2S,3R,4S,5R)-5-azido-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=N[C@]1(CO)O[C@@](F)(n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H10FN5O6/c10-9(15-2-1-4(17)12-7(15)20)6(19)5(18)8(3-16,21-9)13-14-11/h1-2,5-6,16,18-19H,3H2,(H,12,17,20)/t5-,6+,8+,9-/m0/s1 |
| InChIKey | OJNWOECPFCWBDF-LWIVVEGESA-N |
| XLogP | -2.13 |
| TPSA | 173.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|