C26H36FN7O2Si — CID 175698921
N-[(1R)-1-[2-(azidomethyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-fluoro-3H-1-benzofuran-7-yl]ethyl]-2-ethylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 175698921) has the molecular formula C26H36FN7O2Si and a molecular weight of 525.71 g/mol. Its IUPAC name is N-[(1R)-1-[2-(azidomethyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-fluoro-3H-1-benzofuran-7-yl]ethyl]-2-ethylpyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-[(1R)-1-[2-(azidomethyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-fluoro-3H-1-benzofuran-7-yl]ethyl]-2-ethylpyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 175698921 |
| Molecular Formula | C26H36FN7O2Si |
| Molecular Weight | 525.71 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | N-[(1R)-1-[2-(azidomethyl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-fluoro-3H-1-benzofuran-7-yl]ethyl]-2-ethylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | CCc1cc2nc(N[C@H](C)c3cc(F)cc4c3OC(CN=[N+]=[N-])(CO[Si](C)(C)C(C)(C)C)C4)ccn2n1 |
| InChI | InChI=1S/C26H36FN7O2Si/c1-8-20-13-23-31-22(9-10-34(23)32-20)30-17(2)21-12-19(27)11-18-14-26(15-29-33-28,36-24(18)21)16-35-37(6,7)25(3,4)5/h9-13,17H,8,14-16H2,1-7H3,(H,30,31)/t17-,26?/m1/s1 |
| InChIKey | BODBQQDIAUTVIU-SIHBAMTISA-N |
| XLogP | 6.61 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.71 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|