C20H31ClN2O2 — CID 175699695
(2S)-2-amino-2-(4-methylcyclohexyl)-N-[4-(oxan-4-yl)phenyl]acetamide;hydrochloride (PubChem CID 175699695) has the molecular formula C20H31ClN2O2 and a molecular weight of 366.93 g/mol. Its IUPAC name is (2S)-2-amino-2-(4-methylcyclohexyl)-N-[4-(oxan-4-yl)phenyl]acetamide;hydrochloride.
| Compound Name | (2S)-2-amino-2-(4-methylcyclohexyl)-N-[4-(oxan-4-yl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 175699695 |
| Molecular Formula | C20H31ClN2O2 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (2S)-2-amino-2-(4-methylcyclohexyl)-N-[4-(oxan-4-yl)phenyl]acetamide;hydrochloride |
| SMILES | CC1CCC([C@H](N)C(=O)Nc2ccc(C3CCOCC3)cc2)CC1.Cl |
| InChI | InChI=1S/C20H30N2O2.ClH/c1-14-2-4-17(5-3-14)19(21)20(23)22-18-8-6-15(7-9-18)16-10-12-24-13-11-16;/h6-9,14,16-17,19H,2-5,10-13,21H2,1H3,(H,22,23);1H/t14?,17?,19-;/m0./s1 |
| InChIKey | DINDUQIQXPKCLM-LPJIFJKASA-N |
| XLogP | 4.09 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |