C24H32N4O3 — CID 168846687
2-[(1S)-1-(4-methylcyclohexyl)-2-[4-(oxan-4-yl)anilino]-2-oxoethyl]pyrazole-3-carboxamide (PubChem CID 168846687) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-[(1S)-1-(4-methylcyclohexyl)-2-[4-(oxan-4-yl)anilino]-2-oxoethyl]pyrazole-3-carboxamide.
| Compound Name | 2-[(1S)-1-(4-methylcyclohexyl)-2-[4-(oxan-4-yl)anilino]-2-oxoethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 168846687 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 2-[(1S)-1-(4-methylcyclohexyl)-2-[4-(oxan-4-yl)anilino]-2-oxoethyl]pyrazole-3-carboxamide |
| SMILES | CC1CCC([C@@H](C(=O)Nc2ccc(C3CCOCC3)cc2)n2nccc2C(N)=O)CC1 |
| InChI | InChI=1S/C24H32N4O3/c1-16-2-4-19(5-3-16)22(28-21(23(25)29)10-13-26-28)24(30)27-20-8-6-17(7-9-20)18-11-14-31-15-12-18/h6-10,13,16,18-19,22H,2-5,11-12,14-15H2,1H3,(H2,25,29)(H,27,30)/t16?,19?,22-/m0/s1 |
| InChIKey | GCZPGJPESXIDND-NZBFNNPHSA-N |
| XLogP | 3.88 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |