About 3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one
3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one (PubChem CID 175700137) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one.
Analyze 3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one?
The IUPAC name of 3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one (CID 175700137) is 3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one.
What is the SMILES notation for 3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one?
The canonical SMILES for 3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one is O=C1CC2CCNC2O1.
What is the InChIKey of 3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one?
The InChIKey is AZUGVQHCRWCYIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c8-5-3-4-1-2-7-6(4)9-5/h4,6-7H,1-3H2.
What are the key properties of 3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one?
3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one has a molecular weight of 127.14 g/mol, XLogP of -0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3a,4,5,6,6a-hexahydrofuro[2,3-b]pyrrol-2-one is sourced from PubChem (CID 175700137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).