C23H20N6O — CID 175700547
2-amino-4-[1-(1-methyl-4-oxo-2-phenylquinolin-3-yl)ethylamino]pyrimidine-5-carbonitrile (PubChem CID 175700547) has the molecular formula C23H20N6O and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-amino-4-[1-(1-methyl-4-oxo-2-phenylquinolin-3-yl)ethylamino]pyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-[1-(1-methyl-4-oxo-2-phenylquinolin-3-yl)ethylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 175700547 |
| Molecular Formula | C23H20N6O |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-amino-4-[1-(1-methyl-4-oxo-2-phenylquinolin-3-yl)ethylamino]pyrimidine-5-carbonitrile |
| SMILES | CC(Nc1nc(N)ncc1C#N)c1c(-c2ccccc2)n(C)c2ccccc2c1=O |
| InChI | InChI=1S/C23H20N6O/c1-14(27-22-16(12-24)13-26-23(25)28-22)19-20(15-8-4-3-5-9-15)29(2)18-11-7-6-10-17(18)21(19)30/h3-11,13-14H,1-2H3,(H3,25,26,27,28) |
| InChIKey | JDMZVZRGPGXLIF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |