C15H32NO9P — CID 175703794
[(2R)-2-(5,5-dimethoxypentanoyloxy)-3-hydroxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 175703794) has the molecular formula C15H32NO9P and a molecular weight of 401.39 g/mol. Its IUPAC name is [(2R)-2-(5,5-dimethoxypentanoyloxy)-3-hydroxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-(5,5-dimethoxypentanoyloxy)-3-hydroxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 175703794 |
| Molecular Formula | C15H32NO9P |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [(2R)-2-(5,5-dimethoxypentanoyloxy)-3-hydroxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | COC(CCCC(=O)O[C@H](CO)COP(=O)([O-])OCC[N+](C)(C)C)OC |
| InChI | InChI=1S/C15H32NO9P/c1-16(2,3)9-10-23-26(19,20)24-12-13(11-17)25-14(18)7-6-8-15(21-4)22-5/h13,15,17H,6-12H2,1-5H3/t13-/m1/s1 |
| InChIKey | KPRWAWHLOVNEFI-CYBMUJFWSA-N |
| XLogP | -0.11 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|