C12H11F3N2O — CID 175704471
1-[(2S)-1,1,1-trifluorobutan-2-yl]-1,8-naphthyridin-4-one (PubChem CID 175704471) has the molecular formula C12H11F3N2O and a molecular weight of 256.23 g/mol. Its IUPAC name is 1-[(2S)-1,1,1-trifluorobutan-2-yl]-1,8-naphthyridin-4-one.
| Compound Name | 1-[(2S)-1,1,1-trifluorobutan-2-yl]-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 175704471 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-[(2S)-1,1,1-trifluorobutan-2-yl]-1,8-naphthyridin-4-one |
| SMILES | CC[C@H](n1ccc(=O)c2cccnc21)C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O/c1-2-10(12(13,14)15)17-7-5-9(18)8-4-3-6-16-11(8)17/h3-7,10H,2H2,1H3/t10-/m0/s1 |
| InChIKey | HUZGOOGTHFRTPY-JTQLQIEISA-N |
| XLogP | 2.91 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |