C16H15N2+ — CID 175706726
8,8-dimethyl-14-aza-1-azoniatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaene (PubChem CID 175706726) has the molecular formula C16H15N2+ and a molecular weight of 235.31 g/mol. Its IUPAC name is 8,8-dimethyl-14-aza-1-azoniatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaene.
| Compound Name | 8,8-dimethyl-14-aza-1-azoniatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaene |
|---|---|
| PubChem CID | 175706726 |
| Molecular Formula | C16H15N2+ |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 8,8-dimethyl-14-aza-1-azoniatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaene |
| SMILES | CC1(C)c2ccccc2-[n+]2c[nH]c3cccc1c32 |
| InChI | InChI=1S/C16H14N2/c1-16(2)11-6-3-4-9-14(11)18-10-17-13-8-5-7-12(16)15(13)18/h3-10H,1-2H3/p+1 |
| InChIKey | ZVWZSLAPIHHQHK-UHFFFAOYSA-O |
| XLogP | 3.08 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|