C25H27FN2O5 — CID 175706821
4-O-tert-butyl 1-O-(9H-fluoren-9-ylmethyl) 6-fluoro-3a,5,6,6a-tetrahydro-3H-pyrrolo[3,2-c][1,2]oxazole-1,4-dicarboxylate (PubChem CID 175706821) has the molecular formula C25H27FN2O5 and a molecular weight of 454.50 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-(9H-fluoren-9-ylmethyl) 6-fluoro-3a,5,6,6a-tetrahydro-3H-pyrrolo[3,2-c][1,2]oxazole-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-(9H-fluoren-9-ylmethyl) 6-fluoro-3a,5,6,6a-tetrahydro-3H-pyrrolo[3,2-c][1,2]oxazole-1,4-dicarboxylate |
|---|---|
| PubChem CID | 175706821 |
| Molecular Formula | C25H27FN2O5 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 4-O-tert-butyl 1-O-(9H-fluoren-9-ylmethyl) 6-fluoro-3a,5,6,6a-tetrahydro-3H-pyrrolo[3,2-c][1,2]oxazole-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)C2C1CON2C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H27FN2O5/c1-25(2,3)33-23(29)27-12-20(26)22-21(27)14-32-28(22)24(30)31-13-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,19-22H,12-14H2,1-3H3 |
| InChIKey | YACPOPSWLGJXDK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |