C21H20FNO4 — CID 67441228
9H-fluoren-9-ylmethyl (3R,3aR,6S,6aS)-6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 67441228) has the molecular formula C21H20FNO4 and a molecular weight of 369.39 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (3R,3aR,6S,6aS)-6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (3R,3aR,6S,6aS)-6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 67441228 |
| Molecular Formula | C21H20FNO4 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (3R,3aR,6S,6aS)-6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1C[C@H](F)[C@H]2OC[C@H](O)[C@H]21 |
| InChI | InChI=1S/C21H20FNO4/c22-17-9-23(19-18(24)11-26-20(17)19)21(25)27-10-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-20,24H,9-11H2/t17-,18-,19+,20+/m0/s1 |
| InChIKey | VIPRMXUARXBLGG-VNTMZGSJSA-N |
| XLogP | 2.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |