C23H25NO7 — CID 132574983
9H-fluoren-9-ylmethyl (2R,4aR,6R,7S,7aS)-7-hydroxy-6-(hydroxymethyl)-2-methoxy-2,3,4a,6,7,7a-hexahydrofuro[3,2-b][1,4]oxazine-4-carboxylate (PubChem CID 132574983) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2R,4aR,6R,7S,7aS)-7-hydroxy-6-(hydroxymethyl)-2-methoxy-2,3,4a,6,7,7a-hexahydrofuro[3,2-b][1,4]oxazine-4-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2R,4aR,6R,7S,7aS)-7-hydroxy-6-(hydroxymethyl)-2-methoxy-2,3,4a,6,7,7a-hexahydrofuro[3,2-b][1,4]oxazine-4-carboxylate |
|---|---|
| PubChem CID | 132574983 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2R,4aR,6R,7S,7aS)-7-hydroxy-6-(hydroxymethyl)-2-methoxy-2,3,4a,6,7,7a-hexahydrofuro[3,2-b][1,4]oxazine-4-carboxylate |
| SMILES | CO[C@H]1CN(C(=O)OCC2c3ccccc3-c3ccccc32)[C@@H]2O[C@H](CO)[C@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C23H25NO7/c1-28-19-10-24(22-21(31-19)20(26)18(11-25)30-22)23(27)29-12-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17-22,25-26H,10-12H2,1H3/t18-,19-,20+,21+,22-/m1/s1 |
| InChIKey | ZOWYZYPJBBGFHT-LXHROKJGSA-N |
| XLogP | 1.69 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |