C23H25NO8 — CID 175378756
9H-fluoren-9-ylmethyl N-acetyl-N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate (PubChem CID 175378756) has the molecular formula C23H25NO8 and a molecular weight of 443.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-acetyl-N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-acetyl-N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 175378756 |
| Molecular Formula | C23H25NO8 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-acetyl-N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate |
| SMILES | CC(=O)N(C(=O)OCC1c2ccccc2-c2ccccc21)[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C23H25NO8/c1-12(26)24(19-21(28)20(27)18(10-25)32-22(19)29)23(30)31-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17-22,25,27-29H,10-11H2,1H3/t18-,19-,20-,21-,22-/m1/s1 |
| InChIKey | USJOJQJAURQXOE-ZGJYDULXSA-N |
| XLogP | 0.58 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |