C18H21NO5 — CID 131735079
(3R,4R,5S,6R)-6-(hydroxymethyl)-3-(N-phenylanilino)oxane-2,4,5-triol (PubChem CID 131735079) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is (3R,4R,5S,6R)-6-(hydroxymethyl)-3-(N-phenylanilino)oxane-2,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-6-(hydroxymethyl)-3-(N-phenylanilino)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 131735079 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (3R,4R,5S,6R)-6-(hydroxymethyl)-3-(N-phenylanilino)oxane-2,4,5-triol |
| SMILES | OC[C@H]1OC(O)[C@H](N(c2ccccc2)c2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H21NO5/c20-11-14-16(21)17(22)15(18(23)24-14)19(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14-18,20-23H,11H2/t14-,15-,16-,17-,18?/m1/s1 |
| InChIKey | BWTUFNPLSDHUKR-XNIMBYMISA-N |
| XLogP | 0.62 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |