C21H25N5O5S — CID 175707955
2-[[2-[(2S,5R)-2-[4-(methanesulfonamido)phenyl]-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide (PubChem CID 175707955) has the molecular formula C21H25N5O5S and a molecular weight of 459.53 g/mol. Its IUPAC name is 2-[[2-[(2S,5R)-2-[4-(methanesulfonamido)phenyl]-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide.
| Compound Name | 2-[[2-[(2S,5R)-2-[4-(methanesulfonamido)phenyl]-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175707955 |
| Molecular Formula | C21H25N5O5S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2-[[2-[(2S,5R)-2-[4-(methanesulfonamido)phenyl]-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@@H](c2ccc(NS(C)(=O)=O)cc2)N(C(=O)C(=O)Nc2ncccc2C(N)=O)C1 |
| InChI | InChI=1S/C21H25N5O5S/c1-13-5-10-17(14-6-8-15(9-7-14)25-32(2,30)31)26(12-13)21(29)20(28)24-19-16(18(22)27)4-3-11-23-19/h3-4,6-9,11,13,17,25H,5,10,12H2,1-2H3,(H2,22,27)(H,23,24,28)/t13-,17+/m1/s1 |
| InChIKey | JXYDPLOTLFNPFG-DYVFJYSZSA-N |
| XLogP | 1.49 |
| TPSA | 151.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|