C24H23NO10 — CID 175708199
(2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;4H-oxazin-3-one (PubChem CID 175708199) has the molecular formula C24H23NO10 and a molecular weight of 485.45 g/mol. Its IUPAC name is (2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;4H-oxazin-3-one.
| Compound Name | (2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;4H-oxazin-3-one |
|---|---|
| PubChem CID | 175708199 |
| Molecular Formula | C24H23NO10 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | (2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;4H-oxazin-3-one |
| SMILES | Cc1ccc(C(=O)O[C@H](C(=O)O)[C@H](OC(=O)c2ccc(C)cc2)C(=O)O)cc1.O=C1CC=CON1 |
| InChI | InChI=1S/C20H18O8.C4H5NO2/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14;6-4-2-1-3-7-5-4/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24);1,3H,2H2,(H,5,6)/t15-,16-;/m0./s1 |
| InChIKey | MTQPNJLHTGLHMC-MOGJOVFKSA-N |
| XLogP | 2.18 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |