C59H52O3P2 — CID 175712371
dibenzofuran-4-yl-[2,7-ditert-butyl-5-[dibenzofuran-4-yl(phenyl)phosphanyl]-9,9-dimethylxanthen-4-yl]-phenylphosphane (PubChem CID 175712371) has the molecular formula C59H52O3P2 and a molecular weight of 871.01 g/mol. Its IUPAC name is dibenzofuran-4-yl-[2,7-ditert-butyl-5-[dibenzofuran-4-yl(phenyl)phosphanyl]-9,9-dimethylxanthen-4-yl]-phenylphosphane.
| Compound Name | dibenzofuran-4-yl-[2,7-ditert-butyl-5-[dibenzofuran-4-yl(phenyl)phosphanyl]-9,9-dimethylxanthen-4-yl]-phenylphosphane |
|---|---|
| PubChem CID | 175712371 |
| Molecular Formula | C59H52O3P2 |
| Molecular Weight | 871.01 g/mol |
| Exact Mass | 870.34 |
| IUPAC Name | dibenzofuran-4-yl-[2,7-ditert-butyl-5-[dibenzofuran-4-yl(phenyl)phosphanyl]-9,9-dimethylxanthen-4-yl]-phenylphosphane |
| SMILES | CC(C)(C)c1cc(P(c2ccccc2)c2cccc3c2oc2ccccc23)c2c(c1)C(C)(C)c1cc(C(C)(C)C)cc(P(c3ccccc3)c3cccc4c3oc3ccccc34)c1O2 |
| InChI | InChI=1S/C59H52O3P2/c1-57(2,3)37-33-45-55(51(35-37)63(39-21-11-9-12-22-39)49-31-19-27-43-41-25-15-17-29-47(41)60-53(43)49)62-56-46(59(45,7)8)34-38(58(4,5)6)36-52(56)64(40-23-13-10-14-24-40)50-32-20-28-44-42-26-16-18-30-48(42)61-54(44)50/h9-36H,1-8H3 |
| InChIKey | ZGTNBRLMQJDBDR-UHFFFAOYSA-N |
| XLogP | 14.03 |
| TPSA | 35.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.01 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|