C19H19FN2O — CID 175719232
(1R)-1-[5-fluoro-2-[2-[(2-methylpyrazol-3-yl)methyl]phenyl]phenyl]ethanol (PubChem CID 175719232) has the molecular formula C19H19FN2O and a molecular weight of 310.37 g/mol. Its IUPAC name is (1R)-1-[5-fluoro-2-[2-[(2-methylpyrazol-3-yl)methyl]phenyl]phenyl]ethanol.
| Compound Name | (1R)-1-[5-fluoro-2-[2-[(2-methylpyrazol-3-yl)methyl]phenyl]phenyl]ethanol |
|---|---|
| PubChem CID | 175719232 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (1R)-1-[5-fluoro-2-[2-[(2-methylpyrazol-3-yl)methyl]phenyl]phenyl]ethanol |
| SMILES | C[C@@H](O)c1cc(F)ccc1-c1ccccc1Cc1ccnn1C |
| InChI | InChI=1S/C19H19FN2O/c1-13(23)19-12-15(20)7-8-18(19)17-6-4-3-5-14(17)11-16-9-10-21-22(16)2/h3-10,12-13,23H,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | QSHUJXTYXXLHPF-CYBMUJFWSA-N |
| XLogP | 3.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |