C13H21F3N2O4 — CID 175719360
N-methyl-1-(3-methyl-1-oxobutan-2-yl)pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 175719360) has the molecular formula C13H21F3N2O4 and a molecular weight of 326.32 g/mol. Its IUPAC name is N-methyl-1-(3-methyl-1-oxobutan-2-yl)pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-methyl-1-(3-methyl-1-oxobutan-2-yl)pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175719360 |
| Molecular Formula | C13H21F3N2O4 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-methyl-1-(3-methyl-1-oxobutan-2-yl)pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)C1CCN(C(C=O)C(C)C)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H20N2O2.C2HF3O2/c1-8(2)10(7-14)13-5-4-9(6-13)11(15)12-3;3-2(4,5)1(6)7/h7-10H,4-6H2,1-3H3,(H,12,15);(H,6,7) |
| InChIKey | RYCBLBKPXUEZBG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|