C9H16F2N4O2 — CID 55213669
1-(1,1-difluoro-2-hydrazinyl-2-oxoethyl)-N-methylpiperidine-4-carboxamide (PubChem CID 55213669) has the molecular formula C9H16F2N4O2 and a molecular weight of 250.25 g/mol. Its IUPAC name is 1-(1,1-difluoro-2-hydrazinyl-2-oxoethyl)-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-(1,1-difluoro-2-hydrazinyl-2-oxoethyl)-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55213669 |
| Molecular Formula | C9H16F2N4O2 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1-(1,1-difluoro-2-hydrazinyl-2-oxoethyl)-N-methylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(C(F)(F)C(=O)NN)CC1 |
| InChI | InChI=1S/C9H16F2N4O2/c1-13-7(16)6-2-4-15(5-3-6)9(10,11)8(17)14-12/h6H,2-5,12H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | WYEMPPVOFFBDDV-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|