C14H28O4Si — CID 175720619
5-[dimethoxy(propyl)silyl]nonane-4,6-dione (PubChem CID 175720619) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is 5-[dimethoxy(propyl)silyl]nonane-4,6-dione.
| Compound Name | 5-[dimethoxy(propyl)silyl]nonane-4,6-dione |
|---|---|
| PubChem CID | 175720619 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 5-[dimethoxy(propyl)silyl]nonane-4,6-dione |
| SMILES | CCCC(=O)C(C(=O)CCC)[Si](CCC)(OC)OC |
| InChI | InChI=1S/C14H28O4Si/c1-6-9-12(15)14(13(16)10-7-2)19(17-4,18-5)11-8-3/h14H,6-11H2,1-5H3 |
| InChIKey | KMMLTQAFRXGCHE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|