C36H56O8PtSi2+2 — CID 175720659
bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+) (PubChem CID 175720659) has the molecular formula C36H56O8PtSi2+2 and a molecular weight of 868.09 g/mol. Its IUPAC name is bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+).
| Compound Name | bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+) |
|---|---|
| PubChem CID | 175720659 |
| Molecular Formula | C36H56O8PtSi2+2 |
| Molecular Weight | 868.09 g/mol |
| Exact Mass | 867.32 |
| IUPAC Name | bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+) |
| SMILES | CCCC[Si](OC)(OC)C(C(=O)CCC)C(=O)c1ccccc1.CCCC[Si](OC)(OC)C(C(=O)CCC)C(=O)c1ccccc1.[Pt+2] |
| InChI | InChI=1S/2C18H28O4Si.Pt/c2*1-5-7-14-23(21-3,22-4)18(16(19)11-6-2)17(20)15-12-9-8-10-13-15;/h2*8-10,12-13,18H,5-7,11,14H2,1-4H3;/q;;+2 |
| InChIKey | ZMYHNZTUVWZVMT-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.09 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|