About bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+)
bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+) (PubChem CID 175720659) has the molecular formula C36H56O8PtSi2+2
and a molecular weight of 868.09 g/mol. Its IUPAC name is bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+).
Molecular Properties
| Compound Name | bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+) |
| PubChem CID | 175720659 |
| Molecular Formula | C36H56O8PtSi2+2 |
| Molecular Weight | 868.09 g/mol |
| Exact Mass | 867.32 |
| IUPAC Name | bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+) |
| SMILES | CCCC[Si](OC)(OC)C(C(=O)CCC)C(=O)c1ccccc1.CCCC[Si](OC)(OC)C(C(=O)CCC)C(=O)c1ccccc1.[Pt+2] |
| InChI | InChI=1S/2C18H28O4Si.Pt/c2*1-5-7-14-23(21-3,22-4)18(16(19)11-6-2)17(20)15-12-9-8-10-13-15;/h2*8-10,12-13,18H,5-7,11,14H2,1-4H3;/q;;+2 |
| InChIKey | ZMYHNZTUVWZVMT-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 868.09 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+)?
The IUPAC name of bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+) (CID 175720659) is bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+).
What is the SMILES notation for bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+)?
The canonical SMILES for bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+) is CCCC[Si](OC)(OC)C(C(=O)CCC)C(=O)c1ccccc1.CCCC[Si](OC)(OC)C(C(=O)CCC)C(=O)c1ccccc1.[Pt+2].
What is the InChIKey of bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+)?
The InChIKey is ZMYHNZTUVWZVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H28O4Si.Pt/c2*1-5-7-14-23(21-3,22-4)18(16(19)11-6-2)17(20)15-12-9-8-10-13-15;/h2*8-10,12-13,18H,5-7,11,14H2,1-4H3;/q;;+2.
What are the key properties of bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+)?
bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+) has a molecular weight of 868.09 g/mol, XLogP of 8.29, 22 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[butyl(dimethoxy)silyl]-1-phenylhexane-1,3-dione);platinum(2+) is sourced from PubChem (CID 175720659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).