C15H22O4Si — CID 175720772
2-[dimethoxy(propyl)silyl]-1-phenylbutane-1,3-dione (PubChem CID 175720772) has the molecular formula C15H22O4Si and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[dimethoxy(propyl)silyl]-1-phenylbutane-1,3-dione.
| Compound Name | 2-[dimethoxy(propyl)silyl]-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 175720772 |
| Molecular Formula | C15H22O4Si |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-[dimethoxy(propyl)silyl]-1-phenylbutane-1,3-dione |
| SMILES | CCC[Si](OC)(OC)C(C(C)=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22O4Si/c1-5-11-20(18-3,19-4)15(12(2)16)14(17)13-9-7-6-8-10-13/h6-10,15H,5,11H2,1-4H3 |
| InChIKey | WNZYWJQDSGDVMC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|