C11H21NO4S — CID 175721393
(2S,3R)-3-methoxy-1-[(2R)-oxolan-2-yl]hex-5-ene-2-sulfonamide (PubChem CID 175721393) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is (2S,3R)-3-methoxy-1-[(2R)-oxolan-2-yl]hex-5-ene-2-sulfonamide.
| Compound Name | (2S,3R)-3-methoxy-1-[(2R)-oxolan-2-yl]hex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 175721393 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (2S,3R)-3-methoxy-1-[(2R)-oxolan-2-yl]hex-5-ene-2-sulfonamide |
| SMILES | C=CC[C@@H](OC)[C@H](C[C@H]1CCCO1)S(N)(=O)=O |
| InChI | InChI=1S/C11H21NO4S/c1-3-5-10(15-2)11(17(12,13)14)8-9-6-4-7-16-9/h3,9-11H,1,4-8H2,2H3,(H2,12,13,14)/t9-,10-,11+/m1/s1 |
| InChIKey | ZCYWBAIBZNHXCE-MXWKQRLJSA-N |
| XLogP | 0.80 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|