About 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole
5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole (PubChem CID 175726578) has the molecular formula C6H8N4O
and a molecular weight of 152.16 g/mol. Its IUPAC name is 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole |
| PubChem CID | 175726578 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole |
| SMILES | C1=NOC(Cn2ccnn2)C1 |
| InChI | InChI=1S/C6H8N4O/c1-2-8-11-6(1)5-10-4-3-7-9-10/h2-4,6H,1,5H2 |
| InChIKey | UZKHMYDHCFWWGA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole?
The IUPAC name of 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole (CID 175726578) is 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole is C1=NOC(Cn2ccnn2)C1.
What is the InChIKey of 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole?
The InChIKey is UZKHMYDHCFWWGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O/c1-2-8-11-6(1)5-10-4-3-7-9-10/h2-4,6H,1,5H2.
What are the key properties of 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole?
5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole has a molecular weight of 152.16 g/mol, XLogP of 0.05, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(triazol-1-ylmethyl)-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 175726578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).