C16H24FNO2S — CID 175727682
(1S)-N-tert-butylsulfanyl-1-[2-fluoro-5-[(3S)-oxolan-3-yl]oxyphenyl]ethanamine (PubChem CID 175727682) has the molecular formula C16H24FNO2S and a molecular weight of 313.44 g/mol. Its IUPAC name is (1S)-N-tert-butylsulfanyl-1-[2-fluoro-5-[(3S)-oxolan-3-yl]oxyphenyl]ethanamine.
| Compound Name | (1S)-N-tert-butylsulfanyl-1-[2-fluoro-5-[(3S)-oxolan-3-yl]oxyphenyl]ethanamine |
|---|---|
| PubChem CID | 175727682 |
| Molecular Formula | C16H24FNO2S |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (1S)-N-tert-butylsulfanyl-1-[2-fluoro-5-[(3S)-oxolan-3-yl]oxyphenyl]ethanamine |
| SMILES | C[C@H](NSC(C)(C)C)c1cc(O[C@H]2CCOC2)ccc1F |
| InChI | InChI=1S/C16H24FNO2S/c1-11(18-21-16(2,3)4)14-9-12(5-6-15(14)17)20-13-7-8-19-10-13/h5-6,9,11,13,18H,7-8,10H2,1-4H3/t11-,13-/m0/s1 |
| InChIKey | ZARNKOCYZKXAAH-AAEUAGOBSA-N |
| XLogP | 4.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|