C26H35F2N3O7S — CID 163210701
(R)-N-[(1S,2S)-2-fluoro-1-[2-fluoro-5-[(3S)-oxolan-3-yl]oxyphenyl]-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]-2-methylpropane-2-sulfinamide (PubChem CID 163210701) has the molecular formula C26H35F2N3O7S and a molecular weight of 571.64 g/mol. Its IUPAC name is (R)-N-[(1S,2S)-2-fluoro-1-[2-fluoro-5-[(3S)-oxolan-3-yl]oxyphenyl]-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S,2S)-2-fluoro-1-[2-fluoro-5-[(3S)-oxolan-3-yl]oxyphenyl]-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 163210701 |
| Molecular Formula | C26H35F2N3O7S |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | (R)-N-[(1S,2S)-2-fluoro-1-[2-fluoro-5-[(3S)-oxolan-3-yl]oxyphenyl]-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@@H](c1cc(O[C@H]2CCOC2)ccc1F)[C@@H](F)CC1C(=O)NC(=O)N(C2CCOCC2)C1=O |
| InChI | InChI=1S/C26H35F2N3O7S/c1-26(2,3)39(35)30-22(18-12-16(4-5-20(18)27)38-17-8-11-37-14-17)21(28)13-19-23(32)29-25(34)31(24(19)33)15-6-9-36-10-7-15/h4-5,12,15,17,19,21-22,30H,6-11,13-14H2,1-3H3,(H,29,32,34)/t17-,19?,21-,22-,39+/m0/s1 |
| InChIKey | XMPWROGHDZDSRM-WXTVQBLSSA-N |
| XLogP | 2.69 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|