C22H28BrF2N3O5S — CID 163210714
(R)-N-[(1S,2R)-1-(5-bromo-2-fluorophenyl)-2-fluoro-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]-2-methylpropane-2-sulfinamide (PubChem CID 163210714) has the molecular formula C22H28BrF2N3O5S and a molecular weight of 564.45 g/mol. Its IUPAC name is (R)-N-[(1S,2R)-1-(5-bromo-2-fluorophenyl)-2-fluoro-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S,2R)-1-(5-bromo-2-fluorophenyl)-2-fluoro-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 163210714 |
| Molecular Formula | C22H28BrF2N3O5S |
| Molecular Weight | 564.45 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | (R)-N-[(1S,2R)-1-(5-bromo-2-fluorophenyl)-2-fluoro-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@@H](c1cc(Br)ccc1F)[C@H](F)CC1C(=O)NC(=O)N(C2CCOCC2)C1=O |
| InChI | InChI=1S/C22H28BrF2N3O5S/c1-22(2,3)34(32)27-18(14-10-12(23)4-5-16(14)24)17(25)11-15-19(29)26-21(31)28(20(15)30)13-6-8-33-9-7-13/h4-5,10,13,15,17-18,27H,6-9,11H2,1-3H3,(H,26,29,31)/t15?,17-,18+,34-/m1/s1 |
| InChIKey | HNUMXJDYYXJPRA-RZLLMGSVSA-N |
| XLogP | 3.28 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|