C28H35FN4O6S — CID 175215019
tert-butyl-[[1-[2-fluoro-5-[(6-methyl-3-pyridinyl)oxy]phenyl]-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]amino]-oxidosulfanium (PubChem CID 175215019) has the molecular formula C28H35FN4O6S and a molecular weight of 574.68 g/mol. Its IUPAC name is tert-butyl-[[1-[2-fluoro-5-[(6-methyl-3-pyridinyl)oxy]phenyl]-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[1-[2-fluoro-5-[(6-methyl-3-pyridinyl)oxy]phenyl]-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175215019 |
| Molecular Formula | C28H35FN4O6S |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | tert-butyl-[[1-[2-fluoro-5-[(6-methyl-3-pyridinyl)oxy]phenyl]-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]amino]-oxidosulfanium |
| SMILES | Cc1ccc(Oc2ccc(F)c(C(CCC3C(=O)NC(=O)N(C4CCOCC4)C3=O)N[S+]([O-])C(C)(C)C)c2)cn1 |
| InChI | InChI=1S/C28H35FN4O6S/c1-17-5-6-20(16-30-17)39-19-7-9-23(29)22(15-19)24(32-40(37)28(2,3)4)10-8-21-25(34)31-27(36)33(26(21)35)18-11-13-38-14-12-18/h5-7,9,15-16,18,21,24,32H,8,10-14H2,1-4H3,(H,31,34,36) |
| InChIKey | UXTQJDJUPGAVSY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 132.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|