C19H22F2N2O4S — CID 175210860
tert-butyl-[[2-carboxy-2-fluoro-1-[2-fluoro-5-[(6-methyl-3-pyridinyl)oxy]phenyl]ethyl]amino]-oxidosulfanium (PubChem CID 175210860) has the molecular formula C19H22F2N2O4S and a molecular weight of 412.46 g/mol. Its IUPAC name is tert-butyl-[[2-carboxy-2-fluoro-1-[2-fluoro-5-[(6-methyl-3-pyridinyl)oxy]phenyl]ethyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[2-carboxy-2-fluoro-1-[2-fluoro-5-[(6-methyl-3-pyridinyl)oxy]phenyl]ethyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175210860 |
| Molecular Formula | C19H22F2N2O4S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | tert-butyl-[[2-carboxy-2-fluoro-1-[2-fluoro-5-[(6-methyl-3-pyridinyl)oxy]phenyl]ethyl]amino]-oxidosulfanium |
| SMILES | Cc1ccc(Oc2ccc(F)c(C(N[S+]([O-])C(C)(C)C)C(F)C(=O)O)c2)cn1 |
| InChI | InChI=1S/C19H22F2N2O4S/c1-11-5-6-13(10-22-11)27-12-7-8-15(20)14(9-12)17(16(21)18(24)25)23-28(26)19(2,3)4/h5-10,16-17,23H,1-4H3,(H,24,25) |
| InChIKey | AFPGRWCSOFCBBL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 94.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|