C24H30FN3O6S — CID 175239230
tert-butyl-[[(1S)-6-fluoro-1-[2-[(5R)-1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]-2-oxoethyl]-2,3-dihydroinden-1-yl]amino]-oxidosulfanium (PubChem CID 175239230) has the molecular formula C24H30FN3O6S and a molecular weight of 507.58 g/mol. Its IUPAC name is tert-butyl-[[(1S)-6-fluoro-1-[2-[(5R)-1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]-2-oxoethyl]-2,3-dihydroinden-1-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-6-fluoro-1-[2-[(5R)-1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]-2-oxoethyl]-2,3-dihydroinden-1-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175239230 |
| Molecular Formula | C24H30FN3O6S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | tert-butyl-[[(1S)-6-fluoro-1-[2-[(5R)-1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]-2-oxoethyl]-2,3-dihydroinden-1-yl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@]1(CC(=O)[C@@H]2C(=O)NC(=O)N(C3CCOCC3)C2=O)CCc2ccc(F)cc21 |
| InChI | InChI=1S/C24H30FN3O6S/c1-23(2,3)35(33)27-24(9-6-14-4-5-15(25)12-17(14)24)13-18(29)19-20(30)26-22(32)28(21(19)31)16-7-10-34-11-8-16/h4-5,12,16,19,27H,6-11,13H2,1-3H3,(H,26,30,32)/t19-,24+,35?/m1/s1 |
| InChIKey | JJPQIBFMMCTEKO-YTGWWGAASA-N |
| XLogP | 1.85 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|