C15H20FNO3S — CID 175239283
tert-butyl-[[(1R)-1-(carboxymethyl)-5-fluoro-2,3-dihydroinden-1-yl]amino]-oxidosulfanium (PubChem CID 175239283) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is tert-butyl-[[(1R)-1-(carboxymethyl)-5-fluoro-2,3-dihydroinden-1-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1R)-1-(carboxymethyl)-5-fluoro-2,3-dihydroinden-1-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175239283 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | tert-butyl-[[(1R)-1-(carboxymethyl)-5-fluoro-2,3-dihydroinden-1-yl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@@]1(CC(=O)O)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C15H20FNO3S/c1-14(2,3)21(20)17-15(9-13(18)19)7-6-10-8-11(16)4-5-12(10)15/h4-5,8,17H,6-7,9H2,1-3H3,(H,18,19)/t15-,21?/m1/s1 |
| InChIKey | WWFMNWMFCUIQGZ-RBFZIWAESA-N |
| XLogP | 2.49 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|