C12H11FO4 — CID 117348464
2-[1-(carboxymethyl)cyclopropyl]-5-fluorobenzoic acid (PubChem CID 117348464) has the molecular formula C12H11FO4 and a molecular weight of 238.21 g/mol. Its IUPAC name is 2-[1-(carboxymethyl)cyclopropyl]-5-fluorobenzoic acid.
| Compound Name | 2-[1-(carboxymethyl)cyclopropyl]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 117348464 |
| Molecular Formula | C12H11FO4 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-[1-(carboxymethyl)cyclopropyl]-5-fluorobenzoic acid |
| SMILES | O=C(O)CC1(c2ccc(F)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C12H11FO4/c13-7-1-2-9(8(5-7)11(16)17)12(3-4-12)6-10(14)15/h1-2,5H,3-4,6H2,(H,14,15)(H,16,17) |
| InChIKey | MHLYTMUWSDGWGV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |