C15H17N3O2 — CID 175733927
tert-butyl N-[4-(2-deuteriopyrimidin-4-yl)phenyl]carbamate (PubChem CID 175733927) has the molecular formula C15H17N3O2 and a molecular weight of 272.33 g/mol. Its IUPAC name is tert-butyl N-[4-(2-deuteriopyrimidin-4-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-deuteriopyrimidin-4-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 175733927 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | tert-butyl N-[4-(2-deuteriopyrimidin-4-yl)phenyl]carbamate |
| SMILES | [2H]c1nccc(-c2ccc(NC(=O)OC(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C15H17N3O2/c1-15(2,3)20-14(19)18-12-6-4-11(5-7-12)13-8-9-16-10-17-13/h4-10H,1-3H3,(H,18,19)/i10D |
| InChIKey | FRCJESYRNGBUEQ-MMIHMFRQSA-N |
| XLogP | 3.49 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |