C32H43FN3O4S- — CID 175736907
CID 175736907 (PubChem CID 175736907) has the molecular formula C32H43FN3O4S- and a molecular weight of 584.78 g/mol.
| Compound Name | CID 175736907 |
|---|---|
| PubChem CID | 175736907 |
| Molecular Formula | C32H43FN3O4S- |
| Molecular Weight | 584.78 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | — |
| SMILES | C[C@H]1C[C@H](C(=O)Nc2cc(C(CC3CC3)/C(c3ccncc3)=[S-](=O)/C(C)(C)C)ccc2F)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C32H43FN3O4S/c1-20-16-27(36(19-20)30(38)40-31(2,3)4)29(37)35-26-18-23(10-11-25(26)33)24(17-21-8-9-21)28(41(39)32(5,6)7)22-12-14-34-15-13-22/h10-15,18,20-21,24,27H,8-9,16-17,19H2,1-7H3,(H,35,37)/q-1/t20-,24?,27+/m0/s1 |
| InChIKey | MKRIJYLCMPQUAL-OEBHRJGQSA-N |
| XLogP | 6.67 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.78 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|