About diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium
diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium (PubChem CID 175740347) has the molecular formula C18H42O3P2+2
and a molecular weight of 368.48 g/mol. Its IUPAC name is diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium.
Molecular Properties
| Compound Name | diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium |
| PubChem CID | 175740347 |
| Molecular Formula | C18H42O3P2+2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium |
| SMILES | CCCC[P+](CC)(CCCC)CCCC.CCO[P+](=O)OCC |
| InChI | InChI=1S/C14H32P.C4H10O3P/c1-5-9-12-15(8-4,13-10-6-2)14-11-7-3;1-3-6-8(5)7-4-2/h5-14H2,1-4H3;3-4H2,1-2H3/q2*+1 |
| InChIKey | QJAVSAJTMVGZGN-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium?
The IUPAC name of diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium (CID 175740347) is diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium.
What is the SMILES notation for diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium?
The canonical SMILES for diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium is CCCC[P+](CC)(CCCC)CCCC.CCO[P+](=O)OCC.
What is the InChIKey of diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium?
The InChIKey is QJAVSAJTMVGZGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32P.C4H10O3P/c1-5-9-12-15(8-4,13-10-6-2)14-11-7-3;1-3-6-8(5)7-4-2/h5-14H2,1-4H3;3-4H2,1-2H3/q2*+1.
What are the key properties of diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium?
diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium has a molecular weight of 368.48 g/mol, XLogP of 7.14, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(oxo)phosphanium;tributyl(ethyl)phosphanium is sourced from PubChem (CID 175740347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).