C21H38O5 — CID 175741411
(Z,12R)-12-hydroxyoctadec-9-enoic acid;prop-2-enoic acid (PubChem CID 175741411) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is (Z,12R)-12-hydroxyoctadec-9-enoic acid;prop-2-enoic acid.
| Compound Name | (Z,12R)-12-hydroxyoctadec-9-enoic acid;prop-2-enoic acid |
|---|---|
| PubChem CID | 175741411 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | (Z,12R)-12-hydroxyoctadec-9-enoic acid;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O3.C3H4O2/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;1-2-3(4)5/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);2H,1H2,(H,4,5)/b12-9-;/t17-;/m1./s1 |
| InChIKey | DZAFFSYOXNVDJG-DPMBMXLASA-N |
| XLogP | 5.34 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|