C24H30N4O4 — CID 175745374
(E)-N-[4-[carbamimidoyl-[(E)-3-(4-hydroxyphenyl)prop-2-enyl]amino]butyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 175745374) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is (E)-N-[4-[carbamimidoyl-[(E)-3-(4-hydroxyphenyl)prop-2-enyl]amino]butyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[carbamimidoyl-[(E)-3-(4-hydroxyphenyl)prop-2-enyl]amino]butyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 175745374 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (E)-N-[4-[carbamimidoyl-[(E)-3-(4-hydroxyphenyl)prop-2-enyl]amino]butyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | [H]/N=C(\N)N(C/C=C/c1ccc(O)cc1)CCCCNC(=O)/C=C/c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C24H30N4O4/c1-32-22-17-19(8-12-21(22)30)9-13-23(31)27-14-2-3-15-28(24(25)26)16-4-5-18-6-10-20(29)11-7-18/h4-13,17,29-30H,2-3,14-16H2,1H3,(H3,25,26)(H,27,31)/b5-4+,13-9+ |
| InChIKey | CBDOZGOFGJIVMQ-CCKNLQGCSA-N |
| XLogP | 2.92 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|