C12H18N3O5P — CID 175745948
1-[(1S)-3,4-dihydro-1H-[1,4]oxazino[4,3-b]indazol-1-yl]-N-methylmethanamine;phosphoric acid (PubChem CID 175745948) has the molecular formula C12H18N3O5P and a molecular weight of 315.27 g/mol. Its IUPAC name is 1-[(1S)-3,4-dihydro-1H-[1,4]oxazino[4,3-b]indazol-1-yl]-N-methylmethanamine;phosphoric acid.
| Compound Name | 1-[(1S)-3,4-dihydro-1H-[1,4]oxazino[4,3-b]indazol-1-yl]-N-methylmethanamine;phosphoric acid |
|---|---|
| PubChem CID | 175745948 |
| Molecular Formula | C12H18N3O5P |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-[(1S)-3,4-dihydro-1H-[1,4]oxazino[4,3-b]indazol-1-yl]-N-methylmethanamine;phosphoric acid |
| SMILES | CNC[C@@H]1OCCn2nc3ccccc3c21.O=P(O)(O)O |
| InChI | InChI=1S/C12H15N3O.H3O4P/c1-13-8-11-12-9-4-2-3-5-10(9)14-15(12)6-7-16-11;1-5(2,3)4/h2-5,11,13H,6-8H2,1H3;(H3,1,2,3,4)/t11-;/m0./s1 |
| InChIKey | PUBDPMFOMJNOBG-MERQFXBCSA-N |
| XLogP | 0.40 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|