C34H32N6O2Zn2 — CID 175746078
3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-1-benzofuran-4-ol;zinc (PubChem CID 175746078) has the molecular formula C34H32N6O2Zn2 and a molecular weight of 687.45 g/mol. Its IUPAC name is 3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-1-benzofuran-4-ol;zinc.
| Compound Name | 3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-1-benzofuran-4-ol;zinc |
|---|---|
| PubChem CID | 175746078 |
| Molecular Formula | C34H32N6O2Zn2 |
| Molecular Weight | 687.45 g/mol |
| Exact Mass | 684.12 |
| IUPAC Name | 3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-1-benzofuran-4-ol;zinc |
| SMILES | Oc1c(CN(Cc2ccccn2)Cc2ccccn2)ccc2occ(CN(Cc3ccccn3)Cc3ccccn3)c12.[Zn].[Zn] |
| InChI | InChI=1S/C34H32N6O2.2Zn/c41-34-26(19-39(21-28-9-1-5-15-35-28)22-29-10-2-6-16-36-29)13-14-32-33(34)27(25-42-32)20-40(23-30-11-3-7-17-37-30)24-31-12-4-8-18-38-31;;/h1-18,25,41H,19-24H2;; |
| InChIKey | QRBFADQUTPZDHQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.45 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|