C12H17NO2 — CID 175746889
2-[(4-methylphenyl)methyl]-1,3-dioxan-5-amine (PubChem CID 175746889) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl]-1,3-dioxan-5-amine.
| Compound Name | 2-[(4-methylphenyl)methyl]-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 175746889 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-[(4-methylphenyl)methyl]-1,3-dioxan-5-amine |
| SMILES | Cc1ccc(CC2OCC(N)CO2)cc1 |
| InChI | InChI=1S/C12H17NO2/c1-9-2-4-10(5-3-9)6-12-14-7-11(13)8-15-12/h2-5,11-12H,6-8,13H2,1H3 |
| InChIKey | WUFDRUUYWYTHFV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |