C48H42N2O5 — CID 175747666
trityl (2S)-1-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxylate (PubChem CID 175747666) has the molecular formula C48H42N2O5 and a molecular weight of 726.87 g/mol. Its IUPAC name is trityl (2S)-1-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxylate.
| Compound Name | trityl (2S)-1-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 175747666 |
| Molecular Formula | C48H42N2O5 |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.31 |
| IUPAC Name | trityl (2S)-1-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxylate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C48H42N2O5/c51-45(43(32-34-18-5-1-6-19-34)49-47(53)54-33-42-40-28-15-13-26-38(40)39-27-14-16-29-41(39)42)50-31-17-30-44(50)46(52)55-48(35-20-7-2-8-21-35,36-22-9-3-10-23-36)37-24-11-4-12-25-37/h1-16,18-29,42-44H,17,30-33H2,(H,49,53)/t43-,44-/m0/s1 |
| InChIKey | SUNIARVBPXBKHM-CXNSMIOJSA-N |
| XLogP | 8.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|