C19H24N2O5 — CID 15484642
methyl (2S)-1-[(2S)-3-phenyl-2-(prop-2-enoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylate (PubChem CID 15484642) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is methyl (2S)-1-[(2S)-3-phenyl-2-(prop-2-enoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(2S)-3-phenyl-2-(prop-2-enoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15484642 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | methyl (2S)-1-[(2S)-3-phenyl-2-(prop-2-enoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylate |
| SMILES | C=CCOC(=O)N[C@@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)OC |
| InChI | InChI=1S/C19H24N2O5/c1-3-12-26-19(24)20-15(13-14-8-5-4-6-9-14)17(22)21-11-7-10-16(21)18(23)25-2/h3-6,8-9,15-16H,1,7,10-13H2,2H3,(H,20,24)/t15-,16-/m0/s1 |
| InChIKey | AXHWNMFURMCICO-HOTGVXAUSA-N |
| XLogP | 1.67 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|