C15H8BrFN2O3S2 — CID 175748467
3-[(4-bromo-2-methyl-1,1-dioxo-3-sulfanylidene-1,2-benzothiazol-5-yl)oxy]-5-fluorobenzonitrile (PubChem CID 175748467) has the molecular formula C15H8BrFN2O3S2 and a molecular weight of 427.28 g/mol. Its IUPAC name is 3-[(4-bromo-2-methyl-1,1-dioxo-3-sulfanylidene-1,2-benzothiazol-5-yl)oxy]-5-fluorobenzonitrile.
| Compound Name | 3-[(4-bromo-2-methyl-1,1-dioxo-3-sulfanylidene-1,2-benzothiazol-5-yl)oxy]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 175748467 |
| Molecular Formula | C15H8BrFN2O3S2 |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 425.91 |
| IUPAC Name | 3-[(4-bromo-2-methyl-1,1-dioxo-3-sulfanylidene-1,2-benzothiazol-5-yl)oxy]-5-fluorobenzonitrile |
| SMILES | CN1C(=S)c2c(ccc(Oc3cc(F)cc(C#N)c3)c2Br)S1(=O)=O |
| InChI | InChI=1S/C15H8BrFN2O3S2/c1-19-15(23)13-12(24(19,20)21)3-2-11(14(13)16)22-10-5-8(7-18)4-9(17)6-10/h2-6H,1H3 |
| InChIKey | MFSPFUUJNCBLKI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|