About 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile
3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile (PubChem CID 122541914) has the molecular formula C15H7BrF3NO3S
and a molecular weight of 418.19 g/mol. Its IUPAC name is 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile.
Molecular Properties
| Compound Name | 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile |
| PubChem CID | 122541914 |
| Molecular Formula | C15H7BrF3NO3S |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 416.93 |
| IUPAC Name | 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(Oc2ccc3c(c2Br)CC(F)(F)S3(=O)=O)c1 |
| InChI | InChI=1S/C15H7BrF3NO3S/c16-14-11-6-15(18,19)24(21,22)13(11)2-1-12(14)23-10-4-8(7-20)3-9(17)5-10/h1-5H,6H2 |
| InChIKey | SUPVMZDEQACXBH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile?
The IUPAC name of 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile (CID 122541914) is 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile.
What is the SMILES notation for 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile?
The canonical SMILES for 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile is N#Cc1cc(F)cc(Oc2ccc3c(c2Br)CC(F)(F)S3(=O)=O)c1.
What is the InChIKey of 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile?
The InChIKey is SUPVMZDEQACXBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7BrF3NO3S/c16-14-11-6-15(18,19)24(21,22)13(11)2-1-12(14)23-10-4-8(7-20)3-9(17)5-10/h1-5H,6H2.
What are the key properties of 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile?
3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile has a molecular weight of 418.19 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-bromo-2,2-difluoro-1,1-dioxo-3H-1-benzothiophen-5-yl)oxy]-5-fluorobenzonitrile is sourced from PubChem (CID 122541914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).