C18H8F7NO2 — CID 166703968
3-fluoro-5-[(2,2,3,3,5,5-hexafluoro-4-hydroxy-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl)oxy]benzonitrile (PubChem CID 166703968) has the molecular formula C18H8F7NO2 and a molecular weight of 403.25 g/mol. Its IUPAC name is 3-fluoro-5-[(2,2,3,3,5,5-hexafluoro-4-hydroxy-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl)oxy]benzonitrile.
| Compound Name | 3-fluoro-5-[(2,2,3,3,5,5-hexafluoro-4-hydroxy-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl)oxy]benzonitrile |
|---|---|
| PubChem CID | 166703968 |
| Molecular Formula | C18H8F7NO2 |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 3-fluoro-5-[(2,2,3,3,5,5-hexafluoro-4-hydroxy-8-tricyclo[5.3.1.04,11]undeca-1(11),7,9-trienyl)oxy]benzonitrile |
| SMILES | N#Cc1cc(F)cc(Oc2ccc3c4c2CC(F)(F)C4(O)C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C18H8F7NO2/c19-9-3-8(7-26)4-10(5-9)28-13-2-1-12-14-11(13)6-15(20,21)16(14,27)18(24,25)17(12,22)23/h1-5,27H,6H2 |
| InChIKey | QUGIHIYEBFFJGR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|