C18H10F4N2O3 — CID 162518173
5-(3-cyano-5-methylphenoxy)-1,1,2,2-tetrafluoro-3,3-dihydroxyindene-4-carbonitrile (PubChem CID 162518173) has the molecular formula C18H10F4N2O3 and a molecular weight of 378.28 g/mol. Its IUPAC name is 5-(3-cyano-5-methylphenoxy)-1,1,2,2-tetrafluoro-3,3-dihydroxyindene-4-carbonitrile.
| Compound Name | 5-(3-cyano-5-methylphenoxy)-1,1,2,2-tetrafluoro-3,3-dihydroxyindene-4-carbonitrile |
|---|---|
| PubChem CID | 162518173 |
| Molecular Formula | C18H10F4N2O3 |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 5-(3-cyano-5-methylphenoxy)-1,1,2,2-tetrafluoro-3,3-dihydroxyindene-4-carbonitrile |
| SMILES | Cc1cc(C#N)cc(Oc2ccc3c(c2C#N)C(O)(O)C(F)(F)C3(F)F)c1 |
| InChI | InChI=1S/C18H10F4N2O3/c1-9-4-10(7-23)6-11(5-9)27-14-3-2-13-15(12(14)8-24)17(25,26)18(21,22)16(13,19)20/h2-6,25-26H,1H3 |
| InChIKey | IIIDRLDDYPKRBF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|